About naphthalene-2,6-dicarboxylic acid
naphthalene-2,6-dicarboxylic acid (PubChem CID 14357) has the molecular formula C12H8O4
and a molecular weight of 216.19 g/mol. Its IUPAC name is naphthalene-2,6-dicarboxylic acid.
Molecular Properties
| Compound Name | naphthalene-2,6-dicarboxylic acid |
| PubChem CID | 14357 |
| Molecular Formula | C12H8O4 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | naphthalene-2,6-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2cc(C(=O)O)ccc2c1 |
| InChI | InChI=1S/C12H8O4/c13-11(14)9-3-1-7-5-10(12(15)16)4-2-8(7)6-9/h1-6H,(H,13,14)(H,15,16) |
| InChIKey | RXOHFPCZGPKIRD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze naphthalene-2,6-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-2,6-dicarboxylic acid?
The IUPAC name of naphthalene-2,6-dicarboxylic acid (CID 14357) is naphthalene-2,6-dicarboxylic acid.
What is the SMILES notation for naphthalene-2,6-dicarboxylic acid?
The canonical SMILES for naphthalene-2,6-dicarboxylic acid is O=C(O)c1ccc2cc(C(=O)O)ccc2c1.
What is the InChIKey of naphthalene-2,6-dicarboxylic acid?
The InChIKey is RXOHFPCZGPKIRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8O4/c13-11(14)9-3-1-7-5-10(12(15)16)4-2-8(7)6-9/h1-6H,(H,13,14)(H,15,16).
What are the key properties of naphthalene-2,6-dicarboxylic acid?
naphthalene-2,6-dicarboxylic acid has a molecular weight of 216.19 g/mol, XLogP of 2.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-2,6-dicarboxylic acid is sourced from PubChem (CID 14357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).