C33H40N4O — CID 143570613
(2E,4Z)-2-[(E)-2-[3-[2-(1-benzylpiperidin-4-yl)ethyl]-7-[(dimethylamino)methyl]-1,2-benzoxazol-6-yl]prop-1-enyl]hexa-2,4-dienenitrile (PubChem CID 143570613) has the molecular formula C33H40N4O and a molecular weight of 508.71 g/mol. Its IUPAC name is (2E,4Z)-2-[(E)-2-[3-[2-(1-benzylpiperidin-4-yl)ethyl]-7-[(dimethylamino)methyl]-1,2-benzoxazol-6-yl]prop-1-enyl]hexa-2,4-dienenitrile.
| Compound Name | (2E,4Z)-2-[(E)-2-[3-[2-(1-benzylpiperidin-4-yl)ethyl]-7-[(dimethylamino)methyl]-1,2-benzoxazol-6-yl]prop-1-enyl]hexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 143570613 |
| Molecular Formula | C33H40N4O |
| Molecular Weight | 508.71 g/mol |
| Exact Mass | 508.32 |
| IUPAC Name | (2E,4Z)-2-[(E)-2-[3-[2-(1-benzylpiperidin-4-yl)ethyl]-7-[(dimethylamino)methyl]-1,2-benzoxazol-6-yl]prop-1-enyl]hexa-2,4-dienenitrile |
| SMILES | C/C=C\C=C(C#N)/C=C(\C)c1ccc2c(CCC3CCN(Cc4ccccc4)CC3)noc2c1CN(C)C |
| InChI | InChI=1S/C33H40N4O/c1-5-6-10-28(22-34)21-25(2)29-14-15-30-32(35-38-33(30)31(29)24-36(3)4)16-13-26-17-19-37(20-18-26)23-27-11-8-7-9-12-27/h5-12,14-15,21,26H,13,16-20,23-24H2,1-4H3/b6-5-,25-21+,28-10+ |
| InChIKey | AMSPVJDVBRHTGU-KEQBDHMKSA-N |
| XLogP | 7.16 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.71 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|