About ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine
ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine (PubChem CID 143570836) has the molecular formula C10H22N2
and a molecular weight of 170.30 g/mol. Its IUPAC name is ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine.
Molecular Properties
| Compound Name | ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine |
| PubChem CID | 143570836 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine |
| SMILES | CC.CC.[H]/N=C/C(C)=N/C=C\C |
| InChI | InChI=1S/C6H10N2.2C2H6/c1-3-4-8-6(2)5-7;2*1-2/h3-5,7H,1-2H3;2*1-2H3/b4-3-,7-5+,8-6+;; |
| InChIKey | CQKUVJOPENLVMK-KEMJTJDISA-N |
| XLogP | 3.68 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine?
The IUPAC name of ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine (CID 143570836) is ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine.
What is the SMILES notation for ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine?
The canonical SMILES for ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine is CC.CC.[H]/N=C/C(C)=N/C=C\C.
What is the InChIKey of ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine?
The InChIKey is CQKUVJOPENLVMK-KEMJTJDISA-N. The full InChI is InChI=1S/C6H10N2.2C2H6/c1-3-4-8-6(2)5-7;2*1-2/h3-5,7H,1-2H3;2*1-2H3/b4-3-,7-5+,8-6+;;.
What are the key properties of ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine?
ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine has a molecular weight of 170.30 g/mol, XLogP of 3.68, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-N-[(Z)-prop-1-enyl]propane-1,2-diimine is sourced from PubChem (CID 143570836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).