C9H5N5O2 — CID 143571075
6-N,6-N-dicyanopyridine-2,6-dicarboxamide (PubChem CID 143571075) has the molecular formula C9H5N5O2 and a molecular weight of 215.17 g/mol. Its IUPAC name is 6-N,6-N-dicyanopyridine-2,6-dicarboxamide.
| Compound Name | 6-N,6-N-dicyanopyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 143571075 |
| Molecular Formula | C9H5N5O2 |
| Molecular Weight | 215.17 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 6-N,6-N-dicyanopyridine-2,6-dicarboxamide |
| SMILES | N#CN(C#N)C(=O)c1cccc(C(N)=O)n1 |
| InChI | InChI=1S/C9H5N5O2/c10-4-14(5-11)9(16)7-3-1-2-6(13-7)8(12)15/h1-3H,(H2,12,15) |
| InChIKey | HNJIHLQXSBPHPT-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 123.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.17 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|