About methylcyclohexane;1-methyl-3-pentylpiperidine
methylcyclohexane;1-methyl-3-pentylpiperidine (PubChem CID 143571089) has the molecular formula C18H37N
and a molecular weight of 267.50 g/mol. Its IUPAC name is methylcyclohexane;1-methyl-3-pentylpiperidine.
Molecular Properties
| Compound Name | methylcyclohexane;1-methyl-3-pentylpiperidine |
| PubChem CID | 143571089 |
| Molecular Formula | C18H37N |
| Molecular Weight | 267.50 g/mol |
| Exact Mass | 267.29 |
| IUPAC Name | methylcyclohexane;1-methyl-3-pentylpiperidine |
| SMILES | CC1CCCCC1.CCCCCC1CCCN(C)C1 |
| InChI | InChI=1S/C11H23N.C7H14/c1-3-4-5-7-11-8-6-9-12(2)10-11;1-7-5-3-2-4-6-7/h11H,3-10H2,1-2H3;7H,2-6H2,1H3 |
| InChIKey | BRHZRAWQWQVSNT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methylcyclohexane;1-methyl-3-pentylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylcyclohexane;1-methyl-3-pentylpiperidine?
The IUPAC name of methylcyclohexane;1-methyl-3-pentylpiperidine (CID 143571089) is methylcyclohexane;1-methyl-3-pentylpiperidine.
What is the SMILES notation for methylcyclohexane;1-methyl-3-pentylpiperidine?
The canonical SMILES for methylcyclohexane;1-methyl-3-pentylpiperidine is CC1CCCCC1.CCCCCC1CCCN(C)C1.
What is the InChIKey of methylcyclohexane;1-methyl-3-pentylpiperidine?
The InChIKey is BRHZRAWQWQVSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N.C7H14/c1-3-4-5-7-11-8-6-9-12(2)10-11;1-7-5-3-2-4-6-7/h11H,3-10H2,1-2H3;7H,2-6H2,1H3.
What are the key properties of methylcyclohexane;1-methyl-3-pentylpiperidine?
methylcyclohexane;1-methyl-3-pentylpiperidine has a molecular weight of 267.50 g/mol, XLogP of 5.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methylcyclohexane;1-methyl-3-pentylpiperidine is sourced from PubChem (CID 143571089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).