About 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine
3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine (PubChem CID 143571300) has the molecular formula C19H33N
and a molecular weight of 275.48 g/mol. Its IUPAC name is 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine.
Molecular Properties
| Compound Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine |
| PubChem CID | 143571300 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine |
| SMILES | C=C/C=C(\C=C)C1CCCN(CC(CCC)CCC)C1 |
| InChI | InChI=1S/C19H33N/c1-5-10-17(11-6-2)15-20-14-9-13-19(16-20)18(8-4)12-7-3/h7-8,12,17,19H,3-6,9-11,13-16H2,1-2H3/b18-12+ |
| InChIKey | PQYHTOBCCYMYPS-LDADJPATSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine?
The IUPAC name of 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine (CID 143571300) is 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine.
What is the SMILES notation for 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine?
The canonical SMILES for 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine is C=C/C=C(\C=C)C1CCCN(CC(CCC)CCC)C1.
What is the InChIKey of 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine?
The InChIKey is PQYHTOBCCYMYPS-LDADJPATSA-N. The full InChI is InChI=1S/C19H33N/c1-5-10-17(11-6-2)15-20-14-9-13-19(16-20)18(8-4)12-7-3/h7-8,12,17,19H,3-6,9-11,13-16H2,1-2H3/b18-12+.
What are the key properties of 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine?
3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine has a molecular weight of 275.48 g/mol, XLogP of 5.21, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3E)-hexa-1,3,5-trien-3-yl]-1-(2-propylpentyl)piperidine is sourced from PubChem (CID 143571300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).