About (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane
(1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane (PubChem CID 143571463) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane.
Molecular Properties
| Compound Name | (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane |
| PubChem CID | 143571463 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane |
| SMILES | CC.CCC[C@@H](c1ccc(C)nc1)N(C)C |
| InChI | InChI=1S/C12H20N2.C2H6/c1-5-6-12(14(3)4)11-8-7-10(2)13-9-11;1-2/h7-9,12H,5-6H2,1-4H3;1-2H3/t12-;/m0./s1 |
| InChIKey | MJGZSUGPVXRBQR-YDALLXLXSA-N |
| XLogP | 3.82 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane?
The IUPAC name of (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane (CID 143571463) is (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane.
What is the SMILES notation for (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane?
The canonical SMILES for (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane is CC.CCC[C@@H](c1ccc(C)nc1)N(C)C.
What is the InChIKey of (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane?
The InChIKey is MJGZSUGPVXRBQR-YDALLXLXSA-N. The full InChI is InChI=1S/C12H20N2.C2H6/c1-5-6-12(14(3)4)11-8-7-10(2)13-9-11;1-2/h7-9,12H,5-6H2,1-4H3;1-2H3/t12-;/m0./s1.
What are the key properties of (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane?
(1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane has a molecular weight of 222.38 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N,N-dimethyl-1-(6-methyl-3-pyridinyl)butan-1-amine;ethane is sourced from PubChem (CID 143571463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).