C12H14F5N — CID 143571830
2,3-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)butan-2-amine (PubChem CID 143571830) has the molecular formula C12H14F5N and a molecular weight of 267.24 g/mol. Its IUPAC name is 2,3-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)butan-2-amine.
| Compound Name | 2,3-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)butan-2-amine |
|---|---|
| PubChem CID | 143571830 |
| Molecular Formula | C12H14F5N |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 2,3-dimethyl-3-(2,3,4,5,6-pentafluorophenyl)butan-2-amine |
| SMILES | CC(C)(N)C(C)(C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H14F5N/c1-11(2,12(3,4)18)5-6(13)8(15)10(17)9(16)7(5)14/h18H2,1-4H3 |
| InChIKey | RSZQZGLIDFTVIH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|