C8H15N3O — CID 143571872
N-[(1,2-dimethyl-3H-pyrazol-4-yl)methyl]acetamide (PubChem CID 143571872) has the molecular formula C8H15N3O and a molecular weight of 169.23 g/mol. Its IUPAC name is N-[(1,2-dimethyl-3H-pyrazol-4-yl)methyl]acetamide.
| Compound Name | N-[(1,2-dimethyl-3H-pyrazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 143571872 |
| Molecular Formula | C8H15N3O |
| Molecular Weight | 169.23 g/mol |
| Exact Mass | 169.12 |
| IUPAC Name | N-[(1,2-dimethyl-3H-pyrazol-4-yl)methyl]acetamide |
| SMILES | CC(=O)NCC1=CN(C)N(C)C1 |
| InChI | InChI=1S/C8H15N3O/c1-7(12)9-4-8-5-10(2)11(3)6-8/h5H,4,6H2,1-3H3,(H,9,12) |
| InChIKey | KIPUGYJWCCFFBC-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.23 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |