C10H20N4O3 — CID 143571906
N'-[2-(3,6-dioxodiazinan-1-yl)ethyl]acetohydrazide;ethane (PubChem CID 143571906) has the molecular formula C10H20N4O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is N'-[2-(3,6-dioxodiazinan-1-yl)ethyl]acetohydrazide;ethane.
| Compound Name | N'-[2-(3,6-dioxodiazinan-1-yl)ethyl]acetohydrazide;ethane |
|---|---|
| PubChem CID | 143571906 |
| Molecular Formula | C10H20N4O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | N'-[2-(3,6-dioxodiazinan-1-yl)ethyl]acetohydrazide;ethane |
| SMILES | CC.CC(=O)NNCCN1NC(=O)CCC1=O |
| InChI | InChI=1S/C8H14N4O3.C2H6/c1-6(13)10-9-4-5-12-8(15)3-2-7(14)11-12;1-2/h9H,2-5H2,1H3,(H,10,13)(H,11,14);1-2H3 |
| InChIKey | HZSCDCJKZYGPOM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|