C25H27N6O3PS2 — CID 143572435
N-[(E,2E)-2-ethylidene-7-[5-morpholin-4-yl-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-8-thia-2,4-diaza-7-phosphabicyclo[4.2.0]octa-1,3,5-trien-7-yl]hept-6-en-3-ynyl]methanesulfonamide (PubChem CID 143572435) has the molecular formula C25H27N6O3PS2 and a molecular weight of 554.64 g/mol. Its IUPAC name is N-[(E,2E)-2-ethylidene-7-[5-morpholin-4-yl-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-8-thia-2,4-diaza-7-phosphabicyclo[4.2.0]octa-1,3,5-trien-7-yl]hept-6-en-3-ynyl]methanesulfonamide.
| Compound Name | N-[(E,2E)-2-ethylidene-7-[5-morpholin-4-yl-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-8-thia-2,4-diaza-7-phosphabicyclo[4.2.0]octa-1,3,5-trien-7-yl]hept-6-en-3-ynyl]methanesulfonamide |
|---|---|
| PubChem CID | 143572435 |
| Molecular Formula | C25H27N6O3PS2 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.13 |
| IUPAC Name | N-[(E,2E)-2-ethylidene-7-[5-morpholin-4-yl-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)-8-thia-2,4-diaza-7-phosphabicyclo[4.2.0]octa-1,3,5-trien-7-yl]hept-6-en-3-ynyl]methanesulfonamide |
| SMILES | C/C=C(\C#CC/C=C/p1sc2nc(-c3cnc4[nH]ccc4c3)nc(N3CCOCC3)c21)CNS(C)(=O)=O |
| InChI | InChI=1S/C25H27N6O3PS2/c1-3-18(16-28-37(2,32)33)7-5-4-6-14-35-21-24(31-10-12-34-13-11-31)29-23(30-25(21)36-35)20-15-19-8-9-26-22(19)27-17-20/h3,6,8-9,14-15,17,28H,4,10-13,16H2,1-2H3,(H,26,27)/b14-6+,18-3+ |
| InChIKey | IGSCUDHZCFZKEE-ZOTYVZBVSA-N |
| XLogP | 4.42 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|