C12H26N2O2 — CID 143572471
N,4,6,7a-tetramethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazol-3-amine;ethane (PubChem CID 143572471) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N,4,6,7a-tetramethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazol-3-amine;ethane.
| Compound Name | N,4,6,7a-tetramethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazol-3-amine;ethane |
|---|---|
| PubChem CID | 143572471 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | N,4,6,7a-tetramethyl-3a,4,6,7-tetrahydro-2H-pyrano[3,4-d][1,3]oxazol-3-amine;ethane |
| SMILES | CC.CNN1COC2(C)CC(C)OC(C)C12 |
| InChI | InChI=1S/C10H20N2O2.C2H6/c1-7-5-10(3)9(8(2)14-7)12(11-4)6-13-10;1-2/h7-9,11H,5-6H2,1-4H3;1-2H3 |
| InChIKey | ZZHGLPRZXKUPIE-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |