C13H21Cl2NO — CID 143572824
3-(aminomethyl)-4-methylpentan-1-ol;1,2-dichlorobenzene (PubChem CID 143572824) has the molecular formula C13H21Cl2NO and a molecular weight of 278.22 g/mol. Its IUPAC name is 3-(aminomethyl)-4-methylpentan-1-ol;1,2-dichlorobenzene.
| Compound Name | 3-(aminomethyl)-4-methylpentan-1-ol;1,2-dichlorobenzene |
|---|---|
| PubChem CID | 143572824 |
| Molecular Formula | C13H21Cl2NO |
| Molecular Weight | 278.22 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 3-(aminomethyl)-4-methylpentan-1-ol;1,2-dichlorobenzene |
| SMILES | CC(C)C(CN)CCO.Clc1ccccc1Cl |
| InChI | InChI=1S/C7H17NO.C6H4Cl2/c1-6(2)7(5-8)3-4-9;7-5-3-1-2-4-6(5)8/h6-7,9H,3-5,8H2,1-2H3;1-4H |
| InChIKey | VCOSTWFQBSOILU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.22 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |