C6H13NO — CID 143572828
[(3S)-2-(aminomethyl)-3-methylcyclopropyl]methanol (PubChem CID 143572828) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is [(3S)-2-(aminomethyl)-3-methylcyclopropyl]methanol.
| Compound Name | [(3S)-2-(aminomethyl)-3-methylcyclopropyl]methanol |
|---|---|
| PubChem CID | 143572828 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | [(3S)-2-(aminomethyl)-3-methylcyclopropyl]methanol |
| SMILES | C[C@H]1C(CN)C1CO |
| InChI | InChI=1S/C6H13NO/c1-4-5(2-7)6(4)3-8/h4-6,8H,2-3,7H2,1H3/t4-,5?,6?/m0/s1 |
| InChIKey | POROBSCZGLDCAG-KXGSVCODSA-N |
| XLogP | -0.18 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |