About (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine
(3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine (PubChem CID 143573168) has the molecular formula C22H30N2O4S2
and a molecular weight of 450.63 g/mol. Its IUPAC name is (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine |
| PubChem CID | 143573168 |
| Molecular Formula | C22H30N2O4S2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine |
| SMILES | CCN(Sc1ccc(OC)c(OC)c1)[C@H]1CCN(Sc2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C22H30N2O4S2/c1-6-24(30-18-8-10-20(26-3)22(14-18)28-5)16-11-12-23(15-16)29-17-7-9-19(25-2)21(13-17)27-4/h7-10,13-14,16H,6,11-12,15H2,1-5H3/t16-/m0/s1 |
| InChIKey | ZDUVOTVQJDLXTP-INIZCTEOSA-N |
| XLogP | 4.83 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine?
The IUPAC name of (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine (CID 143573168) is (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine.
What is the SMILES notation for (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine?
The canonical SMILES for (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine is CCN(Sc1ccc(OC)c(OC)c1)[C@H]1CCN(Sc2ccc(OC)c(OC)c2)C1.
What is the InChIKey of (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine?
The InChIKey is ZDUVOTVQJDLXTP-INIZCTEOSA-N. The full InChI is InChI=1S/C22H30N2O4S2/c1-6-24(30-18-8-10-20(26-3)22(14-18)28-5)16-11-12-23(15-16)29-17-7-9-19(25-2)21(13-17)27-4/h7-10,13-14,16H,6,11-12,15H2,1-5H3/t16-/m0/s1.
What are the key properties of (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine?
(3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine has a molecular weight of 450.63 g/mol, XLogP of 4.83, 10 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N,1-bis[(3,4-dimethoxyphenyl)sulfanyl]-N-ethylpyrrolidin-3-amine is sourced from PubChem (CID 143573168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).