C27H29N9O5S — CID 143573527
4-[2-[7-[2-(1,3-dioxolan-2-yl)-1,3-thiazol-4-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]-N-hydrazinyl-N-phenylpiperazine-1-carboximidamide (PubChem CID 143573527) has the molecular formula C27H29N9O5S and a molecular weight of 591.65 g/mol. Its IUPAC name is 4-[2-[7-[2-(1,3-dioxolan-2-yl)-1,3-thiazol-4-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]-N-hydrazinyl-N-phenylpiperazine-1-carboximidamide.
| Compound Name | 4-[2-[7-[2-(1,3-dioxolan-2-yl)-1,3-thiazol-4-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]-N-hydrazinyl-N-phenylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 143573527 |
| Molecular Formula | C27H29N9O5S |
| Molecular Weight | 591.65 g/mol |
| Exact Mass | 591.20 |
| IUPAC Name | 4-[2-[7-[2-(1,3-dioxolan-2-yl)-1,3-thiazol-4-yl]-4-methoxy-1H-pyrrolo[2,3-c]pyridin-3-yl]-2-oxoacetyl]-N-hydrazinyl-N-phenylpiperazine-1-carboximidamide |
| SMILES | [H]/N=C(\N1CCN(C(=O)C(=O)c2c[nH]c3c(-c4csc(C5OCCO5)n4)ncc(OC)c23)CC1)N(NN)c1ccccc1 |
| InChI | InChI=1S/C27H29N9O5S/c1-39-19-14-31-21(18-15-42-24(32-18)26-40-11-12-41-26)22-20(19)17(13-30-22)23(37)25(38)34-7-9-35(10-8-34)27(28)36(33-29)16-5-3-2-4-6-16/h2-6,13-15,26,28,30,33H,7-12,29H2,1H3/b28-27+ |
| InChIKey | FNRWFELYJLQSGF-BYYHNAKLSA-N |
| XLogP | 1.89 |
| TPSA | 175.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.65 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|