About 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one
4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one (PubChem CID 143573700) has the molecular formula C24H25Cl2F2NO3
and a molecular weight of 484.37 g/mol. Its IUPAC name is 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one |
| PubChem CID | 143573700 |
| Molecular Formula | C24H25Cl2F2NO3 |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 483.12 |
| IUPAC Name | 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one |
| SMILES | Cc1c(Cl)cc(-c2ccc(C(=O)O)cc2)cc1Cl.O=C1CCCN1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H10Cl2O2.C10H15F2NO/c1-8-12(15)6-11(7-13(8)16)9-2-4-10(5-3-9)14(17)18;11-10(12)5-3-8(4-6-10)13-7-1-2-9(13)14/h2-7H,1H3,(H,17,18);8H,1-7H2 |
| InChIKey | LWTUTOGQUQUADC-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one?
The IUPAC name of 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one (CID 143573700) is 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one.
What is the SMILES notation for 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one?
The canonical SMILES for 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one is Cc1c(Cl)cc(-c2ccc(C(=O)O)cc2)cc1Cl.O=C1CCCN1C1CCC(F)(F)CC1.
What is the InChIKey of 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one?
The InChIKey is LWTUTOGQUQUADC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2O2.C10H15F2NO/c1-8-12(15)6-11(7-13(8)16)9-2-4-10(5-3-9)14(17)18;11-10(12)5-3-8(4-6-10)13-7-1-2-9(13)14/h2-7H,1H3,(H,17,18);8H,1-7H2.
What are the key properties of 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one?
4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one has a molecular weight of 484.37 g/mol, XLogP of 6.85, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dichloro-4-methylphenyl)benzoic acid;1-(4,4-difluorocyclohexyl)pyrrolidin-2-one is sourced from PubChem (CID 143573700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).