C12H23NS — CID 143574322
but-1-ene;3-(3-methylbut-1-en-2-yl)-1,3-thiazolidine (PubChem CID 143574322) has the molecular formula C12H23NS and a molecular weight of 213.39 g/mol. Its IUPAC name is but-1-ene;3-(3-methylbut-1-en-2-yl)-1,3-thiazolidine.
| Compound Name | but-1-ene;3-(3-methylbut-1-en-2-yl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 143574322 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | but-1-ene;3-(3-methylbut-1-en-2-yl)-1,3-thiazolidine |
| SMILES | C=C(C(C)C)N1CCSC1.C=CCC |
| InChI | InChI=1S/C8H15NS.C4H8/c1-7(2)8(3)9-4-5-10-6-9;1-3-4-2/h7H,3-6H2,1-2H3;3H,1,4H2,2H3 |
| InChIKey | ULOVRAACGHVELO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|