C18H27N7O — CID 143575101
4-[[4-(1-methyl-5-piperazin-1-ylpyrazol-4-yl)pyrimidin-2-yl]amino]cyclohexan-1-ol (PubChem CID 143575101) has the molecular formula C18H27N7O and a molecular weight of 357.46 g/mol. Its IUPAC name is 4-[[4-(1-methyl-5-piperazin-1-ylpyrazol-4-yl)pyrimidin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[4-(1-methyl-5-piperazin-1-ylpyrazol-4-yl)pyrimidin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 143575101 |
| Molecular Formula | C18H27N7O |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 4-[[4-(1-methyl-5-piperazin-1-ylpyrazol-4-yl)pyrimidin-2-yl]amino]cyclohexan-1-ol |
| SMILES | Cn1ncc(-c2ccnc(NC3CCC(O)CC3)n2)c1N1CCNCC1 |
| InChI | InChI=1S/C18H27N7O/c1-24-17(25-10-8-19-9-11-25)15(12-21-24)16-6-7-20-18(23-16)22-13-2-4-14(26)5-3-13/h6-7,12-14,19,26H,2-5,8-11H2,1H3,(H,20,22,23) |
| InChIKey | HMDAFLVINKOBBZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |