C18H28ClNO — CID 143575996
(1S)-1-[(5S)-4-(2-chloroethyl)-5-methyl-3,7-dimethylidene-2-azabicyclo[3.2.0]heptan-1-yl]hept-6-en-1-ol (PubChem CID 143575996) has the molecular formula C18H28ClNO and a molecular weight of 309.88 g/mol. Its IUPAC name is (1S)-1-[(5S)-4-(2-chloroethyl)-5-methyl-3,7-dimethylidene-2-azabicyclo[3.2.0]heptan-1-yl]hept-6-en-1-ol.
| Compound Name | (1S)-1-[(5S)-4-(2-chloroethyl)-5-methyl-3,7-dimethylidene-2-azabicyclo[3.2.0]heptan-1-yl]hept-6-en-1-ol |
|---|---|
| PubChem CID | 143575996 |
| Molecular Formula | C18H28ClNO |
| Molecular Weight | 309.88 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | (1S)-1-[(5S)-4-(2-chloroethyl)-5-methyl-3,7-dimethylidene-2-azabicyclo[3.2.0]heptan-1-yl]hept-6-en-1-ol |
| SMILES | C=CCCCC[C@H](O)C12NC(=C)C(CCCl)[C@]1(C)CC2=C |
| InChI | InChI=1S/C18H28ClNO/c1-5-6-7-8-9-16(21)18-13(2)12-17(18,4)15(10-11-19)14(3)20-18/h5,15-16,20-21H,1-3,6-12H2,4H3/t15?,16-,17-,18?/m0/s1 |
| InChIKey | OFFVFMWKZCMRRS-SAGYGOJTSA-N |
| XLogP | 4.16 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.88 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|