C19H29NO6S — CID 143576002
S-(3-hydroxy-3-methoxypropyl) (6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6a-methyl-4-oxo-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carbothioate (PubChem CID 143576002) has the molecular formula C19H29NO6S and a molecular weight of 399.51 g/mol. Its IUPAC name is S-(3-hydroxy-3-methoxypropyl) (6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6a-methyl-4-oxo-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carbothioate.
| Compound Name | S-(3-hydroxy-3-methoxypropyl) (6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6a-methyl-4-oxo-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carbothioate |
|---|---|
| PubChem CID | 143576002 |
| Molecular Formula | C19H29NO6S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | S-(3-hydroxy-3-methoxypropyl) (6aS)-6-[(S)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-6a-methyl-4-oxo-2,3,3a,5-tetrahydrofuro[2,3-c]pyrrole-6-carbothioate |
| SMILES | COC(O)CCSC(=O)C1([C@@H](O)[C@@H]2C=CCCC2)NC(=O)C2CCO[C@@]21C |
| InChI | InChI=1S/C19H29NO6S/c1-18-13(8-10-26-18)16(23)20-19(18,15(22)12-6-4-3-5-7-12)17(24)27-11-9-14(21)25-2/h4,6,12-15,21-22H,3,5,7-11H2,1-2H3,(H,20,23)/t12-,13?,14?,15+,18+,19?/m1/s1 |
| InChIKey | GVBNDUHVCIPMAU-CKYDNIDGSA-N |
| XLogP | 0.98 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|