C9H13NO2 — CID 143576054
N-[(3E,5E)-5-hydroxyhepta-1,3,5-trien-4-yl]acetamide (PubChem CID 143576054) has the molecular formula C9H13NO2 and a molecular weight of 167.21 g/mol. Its IUPAC name is N-[(3E,5E)-5-hydroxyhepta-1,3,5-trien-4-yl]acetamide.
| Compound Name | N-[(3E,5E)-5-hydroxyhepta-1,3,5-trien-4-yl]acetamide |
|---|---|
| PubChem CID | 143576054 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-[(3E,5E)-5-hydroxyhepta-1,3,5-trien-4-yl]acetamide |
| SMILES | C=C/C=C(NC(C)=O)\C(O)=C/C |
| InChI | InChI=1S/C9H13NO2/c1-4-6-8(9(12)5-2)10-7(3)11/h4-6,12H,1H2,2-3H3,(H,10,11)/b8-6+,9-5+ |
| InChIKey | JFCXVPQIPPLVLE-RFSWUZDDSA-N |
| XLogP | 1.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|