C19H19ClN8O — CID 143576911
N-[1-(3-chlorophenyl)ethylidene]-N'-hydroxy-2-(3-pyrimidin-5-yl-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrimidin-8-yl)ethanimidamide (PubChem CID 143576911) has the molecular formula C19H19ClN8O and a molecular weight of 410.87 g/mol. Its IUPAC name is N-[1-(3-chlorophenyl)ethylidene]-N'-hydroxy-2-(3-pyrimidin-5-yl-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrimidin-8-yl)ethanimidamide.
| Compound Name | N-[1-(3-chlorophenyl)ethylidene]-N'-hydroxy-2-(3-pyrimidin-5-yl-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrimidin-8-yl)ethanimidamide |
|---|---|
| PubChem CID | 143576911 |
| Molecular Formula | C19H19ClN8O |
| Molecular Weight | 410.87 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[1-(3-chlorophenyl)ethylidene]-N'-hydroxy-2-(3-pyrimidin-5-yl-6,7-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrimidin-8-yl)ethanimidamide |
| SMILES | C/C(=N\C(CN1CCCn2c(-c3cncnc3)nnc21)=N/O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H19ClN8O/c1-13(14-4-2-5-16(20)8-14)23-17(26-29)11-27-6-3-7-28-18(24-25-19(27)28)15-9-21-12-22-10-15/h2,4-5,8-10,12,29H,3,6-7,11H2,1H3/b23-13+,26-17- |
| InChIKey | DGZWBBZQIVZHRZ-MGBXHXQSSA-N |
| XLogP | 2.90 |
| TPSA | 104.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.87 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|