C16H17ClF3N3O3 — CID 143577142
(3S)-3-[[7-chloro-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-1H-indazol-5-yl]methyl]-4-oxobutanoic acid (PubChem CID 143577142) has the molecular formula C16H17ClF3N3O3 and a molecular weight of 391.78 g/mol. Its IUPAC name is (3S)-3-[[7-chloro-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-1H-indazol-5-yl]methyl]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[7-chloro-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-1H-indazol-5-yl]methyl]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 143577142 |
| Molecular Formula | C16H17ClF3N3O3 |
| Molecular Weight | 391.78 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (3S)-3-[[7-chloro-4-[[methyl(2,2,2-trifluoroethyl)amino]methyl]-1H-indazol-5-yl]methyl]-4-oxobutanoic acid |
| SMILES | CN(Cc1c(C[C@H](C=O)CC(=O)O)cc(Cl)c2[nH]ncc12)CC(F)(F)F |
| InChI | InChI=1S/C16H17ClF3N3O3/c1-23(8-16(18,19)20)6-12-10(2-9(7-24)3-14(25)26)4-13(17)15-11(12)5-21-22-15/h4-5,7,9H,2-3,6,8H2,1H3,(H,21,22)(H,25,26)/t9-/m0/s1 |
| InChIKey | CZNZAPSPVABKFV-VIFPVBQESA-N |
| XLogP | 3.04 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.78 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|