C15H15FN2O2 — CID 143577325
4-(8-fluoro-2-oxo-1H-quinolin-3-yl)piperidine-1-carbaldehyde (PubChem CID 143577325) has the molecular formula C15H15FN2O2 and a molecular weight of 274.29 g/mol. Its IUPAC name is 4-(8-fluoro-2-oxo-1H-quinolin-3-yl)piperidine-1-carbaldehyde.
| Compound Name | 4-(8-fluoro-2-oxo-1H-quinolin-3-yl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 143577325 |
| Molecular Formula | C15H15FN2O2 |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 4-(8-fluoro-2-oxo-1H-quinolin-3-yl)piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(c2cc3cccc(F)c3[nH]c2=O)CC1 |
| InChI | InChI=1S/C15H15FN2O2/c16-13-3-1-2-11-8-12(15(20)17-14(11)13)10-4-6-18(9-19)7-5-10/h1-3,8-10H,4-7H2,(H,17,20) |
| InChIKey | BTTJTFUSAGPQKA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|