C16H18N2O5S — CID 14357772
methyl (3R,6S,7aS)-5-oxo-6-(phenylmethoxycarbonylamino)-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 14357772) has the molecular formula C16H18N2O5S and a molecular weight of 350.40 g/mol. Its IUPAC name is methyl (3R,6S,7aS)-5-oxo-6-(phenylmethoxycarbonylamino)-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | methyl (3R,6S,7aS)-5-oxo-6-(phenylmethoxycarbonylamino)-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 14357772 |
| Molecular Formula | C16H18N2O5S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | methyl (3R,6S,7aS)-5-oxo-6-(phenylmethoxycarbonylamino)-3,6,7,7a-tetrahydro-2H-pyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CS[C@H]2C[C@H](NC(=O)OCc3ccccc3)C(=O)N21 |
| InChI | InChI=1S/C16H18N2O5S/c1-22-15(20)12-9-24-13-7-11(14(19)18(12)13)17-16(21)23-8-10-5-3-2-4-6-10/h2-6,11-13H,7-9H2,1H3,(H,17,21)/t11-,12-,13-/m0/s1 |
| InChIKey | SIMGGGUGDLVJKI-AVGNSLFASA-N |
| XLogP | 1.13 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |