About 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol
4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol (PubChem CID 143577939) has the molecular formula C20H23N3O2
and a molecular weight of 337.42 g/mol. Its IUPAC name is 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol.
Molecular Properties
| Compound Name | 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol |
| PubChem CID | 143577939 |
| Molecular Formula | C20H23N3O2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.18 |
| IUPAC Name | 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol |
| SMILES | C=C(O)CCc1ccc(-c2cc(CNc3nc(C)c(C)[nH]3)co2)cc1 |
| InChI | InChI=1S/C20H23N3O2/c1-13(24)4-5-16-6-8-18(9-7-16)19-10-17(12-25-19)11-21-20-22-14(2)15(3)23-20/h6-10,12,24H,1,4-5,11H2,2-3H3,(H2,21,22,23) |
| InChIKey | ARRVVHGIAKSBPT-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol?
The IUPAC name of 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol (CID 143577939) is 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol.
What is the SMILES notation for 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol?
The canonical SMILES for 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol is C=C(O)CCc1ccc(-c2cc(CNc3nc(C)c(C)[nH]3)co2)cc1.
What is the InChIKey of 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol?
The InChIKey is ARRVVHGIAKSBPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N3O2/c1-13(24)4-5-16-6-8-18(9-7-16)19-10-17(12-25-19)11-21-20-22-14(2)15(3)23-20/h6-10,12,24H,1,4-5,11H2,2-3H3,(H2,21,22,23).
What are the key properties of 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol?
4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol has a molecular weight of 337.42 g/mol, XLogP of 4.90, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[4-[[(4,5-dimethyl-1H-imidazol-2-yl)amino]methyl]furan-2-yl]phenyl]but-1-en-2-ol is sourced from PubChem (CID 143577939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).