About 3,6-dibromopyrazin-2-amine;ethane
3,6-dibromopyrazin-2-amine;ethane (PubChem CID 143578228) has the molecular formula C6H9Br2N3
and a molecular weight of 282.97 g/mol. Its IUPAC name is 3,6-dibromopyrazin-2-amine;ethane.
Molecular Properties
| Compound Name | 3,6-dibromopyrazin-2-amine;ethane |
| PubChem CID | 143578228 |
| Molecular Formula | C6H9Br2N3 |
| Molecular Weight | 282.97 g/mol |
| Exact Mass | 280.92 |
| IUPAC Name | 3,6-dibromopyrazin-2-amine;ethane |
| SMILES | CC.Nc1nc(Br)cnc1Br |
| InChI | InChI=1S/C4H3Br2N3.C2H6/c5-2-1-8-3(6)4(7)9-2;1-2/h1H,(H2,7,9);1-2H3 |
| InChIKey | WANYMELFPNGKQT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.97 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,6-dibromopyrazin-2-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dibromopyrazin-2-amine;ethane?
The IUPAC name of 3,6-dibromopyrazin-2-amine;ethane (CID 143578228) is 3,6-dibromopyrazin-2-amine;ethane.
What is the SMILES notation for 3,6-dibromopyrazin-2-amine;ethane?
The canonical SMILES for 3,6-dibromopyrazin-2-amine;ethane is CC.Nc1nc(Br)cnc1Br.
What is the InChIKey of 3,6-dibromopyrazin-2-amine;ethane?
The InChIKey is WANYMELFPNGKQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3Br2N3.C2H6/c5-2-1-8-3(6)4(7)9-2;1-2/h1H,(H2,7,9);1-2H3.
What are the key properties of 3,6-dibromopyrazin-2-amine;ethane?
3,6-dibromopyrazin-2-amine;ethane has a molecular weight of 282.97 g/mol, XLogP of 2.61, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dibromopyrazin-2-amine;ethane is sourced from PubChem (CID 143578228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).