About 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate
3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate (PubChem CID 143579584) has the molecular formula C27H37N3O2
and a molecular weight of 435.61 g/mol. Its IUPAC name is 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate.
Molecular Properties
| Compound Name | 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate |
| PubChem CID | 143579584 |
| Molecular Formula | C27H37N3O2 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.29 |
| IUPAC Name | 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate |
| SMILES | C1CCC2(CC1)CCN(C1CCC1)CC2.COC(=O)c1ccc(-c2ccc(C)nn2)cc1 |
| InChI | InChI=1S/C14H25N.C13H12N2O2/c1-2-7-14(8-3-1)9-11-15(12-10-14)13-5-4-6-13;1-9-3-8-12(15-14-9)10-4-6-11(7-5-10)13(16)17-2/h13H,1-12H2;3-8H,1-2H3 |
| InChIKey | ZIFHUVGYDNPXMJ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate?
The IUPAC name of 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate (CID 143579584) is 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate.
What is the SMILES notation for 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate?
The canonical SMILES for 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate is C1CCC2(CC1)CCN(C1CCC1)CC2.COC(=O)c1ccc(-c2ccc(C)nn2)cc1.
What is the InChIKey of 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate?
The InChIKey is ZIFHUVGYDNPXMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N.C13H12N2O2/c1-2-7-14(8-3-1)9-11-15(12-10-14)13-5-4-6-13;1-9-3-8-12(15-14-9)10-4-6-11(7-5-10)13(16)17-2/h13H,1-12H2;3-8H,1-2H3.
What are the key properties of 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate?
3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate has a molecular weight of 435.61 g/mol, XLogP of 5.82, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclobutyl-3-azaspiro[5.5]undecane;methyl 4-(6-methylpyridazin-3-yl)benzoate is sourced from PubChem (CID 143579584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).