About 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine
2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine (PubChem CID 143579604) has the molecular formula C22H37N3
and a molecular weight of 343.56 g/mol. Its IUPAC name is 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine.
Molecular Properties
| Compound Name | 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine |
| PubChem CID | 143579604 |
| Molecular Formula | C22H37N3 |
| Molecular Weight | 343.56 g/mol |
| Exact Mass | 343.30 |
| IUPAC Name | 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine |
| SMILES | CCCC1(CCC)CCN(c2ccc(CN3CCCC3C)cn2)CC1 |
| InChI | InChI=1S/C22H37N3/c1-4-10-22(11-5-2)12-15-24(16-13-22)21-9-8-20(17-23-21)18-25-14-6-7-19(25)3/h8-9,17,19H,4-7,10-16,18H2,1-3H3 |
| InChIKey | CFALOUIUJPMEQY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine?
The IUPAC name of 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine (CID 143579604) is 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine.
What is the SMILES notation for 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine?
The canonical SMILES for 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine is CCCC1(CCC)CCN(c2ccc(CN3CCCC3C)cn2)CC1.
What is the InChIKey of 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine?
The InChIKey is CFALOUIUJPMEQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H37N3/c1-4-10-22(11-5-2)12-15-24(16-13-22)21-9-8-20(17-23-21)18-25-14-6-7-19(25)3/h8-9,17,19H,4-7,10-16,18H2,1-3H3.
What are the key properties of 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine?
2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine has a molecular weight of 343.56 g/mol, XLogP of 5.25, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,4-dipropylpiperidin-1-yl)-5-[(2-methylpyrrolidin-1-yl)methyl]pyridine is sourced from PubChem (CID 143579604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).