C24H19F3N5OS+ — CID 143579643
[3-[2-(2-amino-1,3-thiazol-5-yl)ethynyl]-4-methylbenzoyl]-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]azanium (PubChem CID 143579643) has the molecular formula C24H19F3N5OS+ and a molecular weight of 482.51 g/mol. Its IUPAC name is [3-[2-(2-amino-1,3-thiazol-5-yl)ethynyl]-4-methylbenzoyl]-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]azanium.
| Compound Name | [3-[2-(2-amino-1,3-thiazol-5-yl)ethynyl]-4-methylbenzoyl]-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]azanium |
|---|---|
| PubChem CID | 143579643 |
| Molecular Formula | C24H19F3N5OS+ |
| Molecular Weight | 482.51 g/mol |
| Exact Mass | 482.13 |
| IUPAC Name | [3-[2-(2-amino-1,3-thiazol-5-yl)ethynyl]-4-methylbenzoyl]-[3-(4-methylimidazol-1-yl)-5-(trifluoromethyl)phenyl]azanium |
| SMILES | Cc1cn(-c2cc([NH2+]C(=O)c3ccc(C)c(C#Cc4cnc(N)s4)c3)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C24H18F3N5OS/c1-14-3-4-17(7-16(14)5-6-21-11-29-23(28)34-21)22(33)31-19-8-18(24(25,26)27)9-20(10-19)32-12-15(2)30-13-32/h3-4,7-13H,1-2H3,(H2,28,29)(H,31,33)/p+1 |
| InChIKey | PYFXCHGPHXUNFA-UHFFFAOYSA-O |
| XLogP | 3.98 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|