C25H26F4N4OS — CID 143579750
N-[1-(4-aminosulfanyl-2-fluoro-5-methylphenyl)ethyl]-4-piperidin-1-yl-2-(trifluoromethyl)quinoline-6-carboxamide (PubChem CID 143579750) has the molecular formula C25H26F4N4OS and a molecular weight of 506.57 g/mol. Its IUPAC name is N-[1-(4-aminosulfanyl-2-fluoro-5-methylphenyl)ethyl]-4-piperidin-1-yl-2-(trifluoromethyl)quinoline-6-carboxamide.
| Compound Name | N-[1-(4-aminosulfanyl-2-fluoro-5-methylphenyl)ethyl]-4-piperidin-1-yl-2-(trifluoromethyl)quinoline-6-carboxamide |
|---|---|
| PubChem CID | 143579750 |
| Molecular Formula | C25H26F4N4OS |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | N-[1-(4-aminosulfanyl-2-fluoro-5-methylphenyl)ethyl]-4-piperidin-1-yl-2-(trifluoromethyl)quinoline-6-carboxamide |
| SMILES | Cc1cc(C(C)NC(=O)c2ccc3nc(C(F)(F)F)cc(N4CCCCC4)c3c2)c(F)cc1SN |
| InChI | InChI=1S/C25H26F4N4OS/c1-14-10-17(19(26)12-22(14)35-30)15(2)31-24(34)16-6-7-20-18(11-16)21(33-8-4-3-5-9-33)13-23(32-20)25(27,28)29/h6-7,10-13,15H,3-5,8-9,30H2,1-2H3,(H,31,34) |
| InChIKey | OTLUVVUVZPTVON-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|