C23H31N5O — CID 143580388
N-[2-[[3-(3,6-diethyl-1H-pyrrolo[3,2-b]pyridin-5-yl)-6-propan-2-yl-2-pyridinyl]amino]ethyl]acetamide (PubChem CID 143580388) has the molecular formula C23H31N5O and a molecular weight of 393.54 g/mol. Its IUPAC name is N-[2-[[3-(3,6-diethyl-1H-pyrrolo[3,2-b]pyridin-5-yl)-6-propan-2-yl-2-pyridinyl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[3-(3,6-diethyl-1H-pyrrolo[3,2-b]pyridin-5-yl)-6-propan-2-yl-2-pyridinyl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 143580388 |
| Molecular Formula | C23H31N5O |
| Molecular Weight | 393.54 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | N-[2-[[3-(3,6-diethyl-1H-pyrrolo[3,2-b]pyridin-5-yl)-6-propan-2-yl-2-pyridinyl]amino]ethyl]acetamide |
| SMILES | CCc1cc2[nH]cc(CC)c2nc1-c1ccc(C(C)C)nc1NCCNC(C)=O |
| InChI | InChI=1S/C23H31N5O/c1-6-16-12-20-22(17(7-2)13-26-20)28-21(16)18-8-9-19(14(3)4)27-23(18)25-11-10-24-15(5)29/h8-9,12-14,26H,6-7,10-11H2,1-5H3,(H,24,29)(H,25,27) |
| InChIKey | PMBRDYJUMIWWLD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.54 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|