C11H15F3S — CID 143581546
ethane;(3E,5Z)-4-(trifluoromethylsulfanyl)octa-1,3,5,7-tetraene (PubChem CID 143581546) has the molecular formula C11H15F3S and a molecular weight of 236.30 g/mol. Its IUPAC name is ethane;(3E,5Z)-4-(trifluoromethylsulfanyl)octa-1,3,5,7-tetraene.
| Compound Name | ethane;(3E,5Z)-4-(trifluoromethylsulfanyl)octa-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 143581546 |
| Molecular Formula | C11H15F3S |
| Molecular Weight | 236.30 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | ethane;(3E,5Z)-4-(trifluoromethylsulfanyl)octa-1,3,5,7-tetraene |
| SMILES | C=C/C=C\C(=C/C=C)SC(F)(F)F.CC |
| InChI | InChI=1S/C9H9F3S.C2H6/c1-3-5-7-8(6-4-2)13-9(10,11)12;1-2/h3-7H,1-2H2;1-2H3/b7-5-,8-6+; |
| InChIKey | DQDBKAXSHWMASV-KHCQPJBVSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.30 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|