C28H24F13NO2 — CID 143581571
8-[3,5-bis(trifluoromethyl)phenyl]-4-(3,3,3-trifluoropropyl)-2,3-dihydro-1,4-benzoxazine;methane;1,1,2,2-tetrafluoroethoxybenzene (PubChem CID 143581571) has the molecular formula C28H24F13NO2 and a molecular weight of 653.48 g/mol. Its IUPAC name is 8-[3,5-bis(trifluoromethyl)phenyl]-4-(3,3,3-trifluoropropyl)-2,3-dihydro-1,4-benzoxazine;methane;1,1,2,2-tetrafluoroethoxybenzene.
| Compound Name | 8-[3,5-bis(trifluoromethyl)phenyl]-4-(3,3,3-trifluoropropyl)-2,3-dihydro-1,4-benzoxazine;methane;1,1,2,2-tetrafluoroethoxybenzene |
|---|---|
| PubChem CID | 143581571 |
| Molecular Formula | C28H24F13NO2 |
| Molecular Weight | 653.48 g/mol |
| Exact Mass | 653.16 |
| IUPAC Name | 8-[3,5-bis(trifluoromethyl)phenyl]-4-(3,3,3-trifluoropropyl)-2,3-dihydro-1,4-benzoxazine;methane;1,1,2,2-tetrafluoroethoxybenzene |
| SMILES | C.FC(F)(F)CCN1CCOc2c(-c3cc(C(F)(F)F)cc(C(F)(F)F)c3)cccc21.FC(F)C(F)(F)Oc1ccccc1 |
| InChI | InChI=1S/C19H14F9NO.C8H6F4O.CH4/c20-17(21,22)4-5-29-6-7-30-16-14(2-1-3-15(16)29)11-8-12(18(23,24)25)10-13(9-11)19(26,27)28;9-7(10)8(11,12)13-6-4-2-1-3-5-6;/h1-3,8-10H,4-7H2;1-5,7H;1H4 |
| InChIKey | NNXPOMYWJPSRGC-UHFFFAOYSA-N |
| XLogP | 10.10 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.48 |
| LogP ≤ 5 | 10.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|