C16H29IN2O4S — CID 143581724
tert-butyl N-[(2S)-1-[4-(2-iodosulfanyloxyethyl)piperidin-1-yl]-1-oxopropan-2-yl]-N-methylcarbamate (PubChem CID 143581724) has the molecular formula C16H29IN2O4S and a molecular weight of 472.39 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[4-(2-iodosulfanyloxyethyl)piperidin-1-yl]-1-oxopropan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(2S)-1-[4-(2-iodosulfanyloxyethyl)piperidin-1-yl]-1-oxopropan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 143581724 |
| Molecular Formula | C16H29IN2O4S |
| Molecular Weight | 472.39 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | tert-butyl N-[(2S)-1-[4-(2-iodosulfanyloxyethyl)piperidin-1-yl]-1-oxopropan-2-yl]-N-methylcarbamate |
| SMILES | C[C@@H](C(=O)N1CCC(CCOSI)CC1)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H29IN2O4S/c1-12(18(5)15(21)23-16(2,3)4)14(20)19-9-6-13(7-10-19)8-11-22-24-17/h12-13H,6-11H2,1-5H3/t12-/m0/s1 |
| InChIKey | ZKLBKBPDDHWFQN-LBPRGKRZSA-N |
| XLogP | 3.89 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|