About (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one
(3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 143582552) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
Molecular Properties
| Compound Name | (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| PubChem CID | 143582552 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | C=C[C@H]1COc2ccccc2NC1=O |
| InChI | InChI=1S/C11H11NO2/c1-2-8-7-14-10-6-4-3-5-9(10)12-11(8)13/h2-6,8H,1,7H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | CZCRFHPPCPVNSH-QMMMGPOBSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one?
The IUPAC name of (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one (CID 143582552) is (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
What is the SMILES notation for (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one?
The canonical SMILES for (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one is C=C[C@H]1COc2ccccc2NC1=O.
What is the InChIKey of (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one?
The InChIKey is CZCRFHPPCPVNSH-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H11NO2/c1-2-8-7-14-10-6-4-3-5-9(10)12-11(8)13/h2-6,8H,1,7H2,(H,12,13)/t8-/m0/s1.
What are the key properties of (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one?
(3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one has a molecular weight of 189.21 g/mol, XLogP of 1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one is sourced from PubChem (CID 143582552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).