C11H11NO2 — CID 143582552
(3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 143582552) has the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. Its IUPAC name is (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
| Compound Name | (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
|---|---|
| PubChem CID | 143582552 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (3S)-3-ethenyl-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | C=C[C@H]1COc2ccccc2NC1=O |
| InChI | InChI=1S/C11H11NO2/c1-2-8-7-14-10-6-4-3-5-9(10)12-11(8)13/h2-6,8H,1,7H2,(H,12,13)/t8-/m0/s1 |
| InChIKey | CZCRFHPPCPVNSH-QMMMGPOBSA-N |
| XLogP | 1.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|