About 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one
5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one (PubChem CID 143582572) has the molecular formula C12H13NO2
and a molecular weight of 203.24 g/mol. Its IUPAC name is 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one.
Molecular Properties
| Compound Name | 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| PubChem CID | 143582572 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one |
| SMILES | C=CCN1C(=O)CCOc2ccccc21 |
| InChI | InChI=1S/C12H13NO2/c1-2-8-13-10-5-3-4-6-11(10)15-9-7-12(13)14/h2-6H,1,7-9H2 |
| InChIKey | OKIWFYOFNFQCLG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one?
The IUPAC name of 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one (CID 143582572) is 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one.
What is the SMILES notation for 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one?
The canonical SMILES for 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one is C=CCN1C(=O)CCOc2ccccc21.
What is the InChIKey of 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one?
The InChIKey is OKIWFYOFNFQCLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO2/c1-2-8-13-10-5-3-4-6-11(10)15-9-7-12(13)14/h2-6H,1,7-9H2.
What are the key properties of 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one?
5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one has a molecular weight of 203.24 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-prop-2-enyl-2,3-dihydro-1,5-benzoxazepin-4-one is sourced from PubChem (CID 143582572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).