About N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene
N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene (PubChem CID 143582585) has the molecular formula C13H26N2
and a molecular weight of 210.36 g/mol. Its IUPAC name is N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene.
Molecular Properties
| Compound Name | N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene |
| PubChem CID | 143582585 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene |
| SMILES | C/C(N)=N\C(C)/C=C\C(C)(C)C.C=CC |
| InChI | InChI=1S/C10H20N2.C3H6/c1-8(12-9(2)11)6-7-10(3,4)5;1-3-2/h6-8H,1-5H3,(H2,11,12);3H,1H2,2H3/b7-6-; |
| InChIKey | SXVIKRTWGJRAQQ-NAFXZHHSSA-N |
| XLogP | 3.55 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene?
The IUPAC name of N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene (CID 143582585) is N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene.
What is the SMILES notation for N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene?
The canonical SMILES for N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene is C/C(N)=N\C(C)/C=C\C(C)(C)C.C=CC.
What is the InChIKey of N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene?
The InChIKey is SXVIKRTWGJRAQQ-NAFXZHHSSA-N. The full InChI is InChI=1S/C10H20N2.C3H6/c1-8(12-9(2)11)6-7-10(3,4)5;1-3-2/h6-8H,1-5H3,(H2,11,12);3H,1H2,2H3/b7-6-;.
What are the key properties of N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene?
N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene has a molecular weight of 210.36 g/mol, XLogP of 3.55, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-5,5-dimethylhex-3-en-2-yl]ethanimidamide;prop-1-ene is sourced from PubChem (CID 143582585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).