C25H36BrN3O3 — CID 143583140
ethyl (Z)-2-[8-bromo-6-(cyclohexylamino)-3-methyl-2,4-dihydro-1,3-benzoxazin-5-yl]-4-pyrrolidin-1-ylbut-2-enoate (PubChem CID 143583140) has the molecular formula C25H36BrN3O3 and a molecular weight of 506.49 g/mol. Its IUPAC name is ethyl (Z)-2-[8-bromo-6-(cyclohexylamino)-3-methyl-2,4-dihydro-1,3-benzoxazin-5-yl]-4-pyrrolidin-1-ylbut-2-enoate.
| Compound Name | ethyl (Z)-2-[8-bromo-6-(cyclohexylamino)-3-methyl-2,4-dihydro-1,3-benzoxazin-5-yl]-4-pyrrolidin-1-ylbut-2-enoate |
|---|---|
| PubChem CID | 143583140 |
| Molecular Formula | C25H36BrN3O3 |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 505.19 |
| IUPAC Name | ethyl (Z)-2-[8-bromo-6-(cyclohexylamino)-3-methyl-2,4-dihydro-1,3-benzoxazin-5-yl]-4-pyrrolidin-1-ylbut-2-enoate |
| SMILES | CCOC(=O)/C(=C\CN1CCCC1)c1c(NC2CCCCC2)cc(Br)c2c1CN(C)CO2 |
| InChI | InChI=1S/C25H36BrN3O3/c1-3-31-25(30)19(11-14-29-12-7-8-13-29)23-20-16-28(2)17-32-24(20)21(26)15-22(23)27-18-9-5-4-6-10-18/h11,15,18,27H,3-10,12-14,16-17H2,1-2H3/b19-11- |
| InChIKey | CTQHKEWGMGJCJH-ODLFYWEKSA-N |
| XLogP | 5.02 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|