C24H24F7NO3 — CID 143583358
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-(hydroxymethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene (PubChem CID 143583358) has the molecular formula C24H24F7NO3 and a molecular weight of 507.45 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-(hydroxymethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-(hydroxymethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene |
|---|---|
| PubChem CID | 143583358 |
| Molecular Formula | C24H24F7NO3 |
| Molecular Weight | 507.45 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-(hydroxymethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene |
| SMILES | Fc1ccccc1.O=C1C(CO)CCC2CC(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CN12 |
| InChI | InChI=1S/C18H19F6NO3.C6H5F/c19-17(20,21)12-3-10(4-13(5-12)18(22,23)24)9-28-15-6-14-2-1-11(8-26)16(27)25(14)7-15;7-6-4-2-1-3-5-6/h3-5,11,14-15,26H,1-2,6-9H2;1-5H |
| InChIKey | XLGUSLYMGUJQBE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.45 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |