C24H24F7NO2 — CID 143583423
2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-methyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene (PubChem CID 143583423) has the molecular formula C24H24F7NO2 and a molecular weight of 491.45 g/mol. Its IUPAC name is 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-methyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene.
| Compound Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-methyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene |
|---|---|
| PubChem CID | 143583423 |
| Molecular Formula | C24H24F7NO2 |
| Molecular Weight | 491.45 g/mol |
| Exact Mass | 491.17 |
| IUPAC Name | 2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-6-methyl-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one;fluorobenzene |
| SMILES | CC1CCC2CC(OCc3cc(C(F)(F)F)cc(C(F)(F)F)c3)CN2C1=O.Fc1ccccc1 |
| InChI | InChI=1S/C18H19F6NO2.C6H5F/c1-10-2-3-14-7-15(8-25(14)16(10)26)27-9-11-4-12(17(19,20)21)6-13(5-11)18(22,23)24;7-6-4-2-1-3-5-6/h4-6,10,14-15H,2-3,7-9H2,1H3;1-5H |
| InChIKey | GUGLRSLAMNPPRH-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.45 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |