C25H24F7NO3 — CID 143583463
(8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-6-(hydroxymethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 143583463) has the molecular formula C25H24F7NO3 and a molecular weight of 519.46 g/mol. Its IUPAC name is (8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-6-(hydroxymethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-6-(hydroxymethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 143583463 |
| Molecular Formula | C25H24F7NO3 |
| Molecular Weight | 519.46 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (8aS)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-1-(4-fluorophenyl)-6-(hydroxymethyl)-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | C[C@@H](OC1CN2C(=O)C(CO)CC[C@H]2C1c1ccc(F)cc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24F7NO3/c1-13(16-8-17(24(27,28)29)10-18(9-16)25(30,31)32)36-21-11-33-20(7-4-15(12-34)23(33)35)22(21)14-2-5-19(26)6-3-14/h2-3,5-6,8-10,13,15,20-22,34H,4,7,11-12H2,1H3/t13-,15?,20+,21?,22?/m1/s1 |
| InChIKey | NQSPXCOKDLZOTL-WOEPMEEFSA-N |
| XLogP | 5.71 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.46 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |