C20H24O4 — CID 143583590
ethane;(2R)-2-[3-[(3-methylphenyl)methoxy]phenoxy]cyclopropane-1-carboxylic acid (PubChem CID 143583590) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is ethane;(2R)-2-[3-[(3-methylphenyl)methoxy]phenoxy]cyclopropane-1-carboxylic acid.
| Compound Name | ethane;(2R)-2-[3-[(3-methylphenyl)methoxy]phenoxy]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 143583590 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | ethane;(2R)-2-[3-[(3-methylphenyl)methoxy]phenoxy]cyclopropane-1-carboxylic acid |
| SMILES | CC.Cc1cccc(COc2cccc(O[C@@H]3CC3C(=O)O)c2)c1 |
| InChI | InChI=1S/C18H18O4.C2H6/c1-12-4-2-5-13(8-12)11-21-14-6-3-7-15(9-14)22-17-10-16(17)18(19)20;1-2/h2-9,16-17H,10-11H2,1H3,(H,19,20);1-2H3/t16?,17-;/m1./s1 |
| InChIKey | UMQNJOOOXCRDMQ-KOUJAAPTSA-N |
| XLogP | 4.45 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |