C10H9N4+ — CID 14358438
3-methyl-6,8,13-triaza-3-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene (PubChem CID 14358438) has the molecular formula C10H9N4+ and a molecular weight of 185.21 g/mol. Its IUPAC name is 3-methyl-6,8,13-triaza-3-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene.
| Compound Name | 3-methyl-6,8,13-triaza-3-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
|---|---|
| PubChem CID | 14358438 |
| Molecular Formula | C10H9N4+ |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | 3-methyl-6,8,13-triaza-3-azoniatricyclo[7.4.0.02,6]trideca-1(9),2,4,7,10,12-hexaene |
| SMILES | C[n+]1ccn2cnc3cccnc3c21 |
| InChI | InChI=1S/C10H9N4/c1-13-5-6-14-7-12-8-3-2-4-11-9(8)10(13)14/h2-7H,1H3/q+1 |
| InChIKey | VBQAESVDOWFVIS-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 34.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|