C31H32ClN3O3 — CID 143584924
methyl 7-chloro-4-[3-[(1R,3Z,6S)-9-naphthalen-2-yl-7,9-diazabicyclo[4.2.2]dec-3-en-7-yl]propoxy]-1H-indole-2-carboxylate (PubChem CID 143584924) has the molecular formula C31H32ClN3O3 and a molecular weight of 530.07 g/mol. Its IUPAC name is methyl 7-chloro-4-[3-[(1R,3Z,6S)-9-naphthalen-2-yl-7,9-diazabicyclo[4.2.2]dec-3-en-7-yl]propoxy]-1H-indole-2-carboxylate.
| Compound Name | methyl 7-chloro-4-[3-[(1R,3Z,6S)-9-naphthalen-2-yl-7,9-diazabicyclo[4.2.2]dec-3-en-7-yl]propoxy]-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 143584924 |
| Molecular Formula | C31H32ClN3O3 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | methyl 7-chloro-4-[3-[(1R,3Z,6S)-9-naphthalen-2-yl-7,9-diazabicyclo[4.2.2]dec-3-en-7-yl]propoxy]-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1cc2c(OCCCN3C[C@H]4C/C=C\C[C@H]3CN4c3ccc4ccccc4c3)ccc(Cl)c2[nH]1 |
| InChI | InChI=1S/C31H32ClN3O3/c1-37-31(36)28-18-26-29(14-13-27(32)30(26)33-28)38-16-6-15-34-19-25-10-5-4-9-24(34)20-35(25)23-12-11-21-7-2-3-8-22(21)17-23/h2-5,7-8,11-14,17-18,24-25,33H,6,9-10,15-16,19-20H2,1H3/b5-4-/t24-,25+/m0/s1 |
| InChIKey | HTHYDEFZCIRREJ-AXTNUDJLSA-N |
| XLogP | 6.44 |
| TPSA | 57.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|