C37H30F3N5O7 — CID 143585495
[4-(nitrooxymethyl)phenyl] 2-(4,6-dimethylpyrimidin-2-yl)oxy-2-[2-oxo-5-phenyl-1-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydro-1,4-benzodiazepin-5-yl]acetate (PubChem CID 143585495) has the molecular formula C37H30F3N5O7 and a molecular weight of 713.67 g/mol. Its IUPAC name is [4-(nitrooxymethyl)phenyl] 2-(4,6-dimethylpyrimidin-2-yl)oxy-2-[2-oxo-5-phenyl-1-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydro-1,4-benzodiazepin-5-yl]acetate.
| Compound Name | [4-(nitrooxymethyl)phenyl] 2-(4,6-dimethylpyrimidin-2-yl)oxy-2-[2-oxo-5-phenyl-1-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydro-1,4-benzodiazepin-5-yl]acetate |
|---|---|
| PubChem CID | 143585495 |
| Molecular Formula | C37H30F3N5O7 |
| Molecular Weight | 713.67 g/mol |
| Exact Mass | 713.21 |
| IUPAC Name | [4-(nitrooxymethyl)phenyl] 2-(4,6-dimethylpyrimidin-2-yl)oxy-2-[2-oxo-5-phenyl-1-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydro-1,4-benzodiazepin-5-yl]acetate |
| SMILES | Cc1cc(C)nc(OC(C(=O)Oc2ccc(CO[N+](=O)[O-])cc2)C2(c3ccccc3)NCC(=O)N(Cc3c(F)cc(F)cc3F)c3ccccc32)n1 |
| InChI | InChI=1S/C37H30F3N5O7/c1-22-16-23(2)43-36(42-22)52-34(35(47)51-27-14-12-24(13-15-27)21-50-45(48)49)37(25-8-4-3-5-9-25)29-10-6-7-11-32(29)44(33(46)19-41-37)20-28-30(39)17-26(38)18-31(28)40/h3-18,34,41H,19-21H2,1-2H3 |
| InChIKey | UGUKLPJUHUKMLJ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 146.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|