C31H32O8P2 — CID 143585942
[3,3-dibenzyl-2-[carboxyoxy(hydroxy)phosphoryl]-1,4-diphenylbutan-2-yl]phosphonic acid (PubChem CID 143585942) has the molecular formula C31H32O8P2 and a molecular weight of 594.54 g/mol. Its IUPAC name is [3,3-dibenzyl-2-[carboxyoxy(hydroxy)phosphoryl]-1,4-diphenylbutan-2-yl]phosphonic acid.
| Compound Name | [3,3-dibenzyl-2-[carboxyoxy(hydroxy)phosphoryl]-1,4-diphenylbutan-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 143585942 |
| Molecular Formula | C31H32O8P2 |
| Molecular Weight | 594.54 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | [3,3-dibenzyl-2-[carboxyoxy(hydroxy)phosphoryl]-1,4-diphenylbutan-2-yl]phosphonic acid |
| SMILES | O=C(O)OP(=O)(O)C(Cc1ccccc1)(C(Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1)P(=O)(O)O |
| InChI | InChI=1S/C31H32O8P2/c32-29(33)39-41(37,38)31(40(34,35)36,24-28-19-11-4-12-20-28)30(21-25-13-5-1-6-14-25,22-26-15-7-2-8-16-26)23-27-17-9-3-10-18-27/h1-20H,21-24H2,(H,32,33)(H,37,38)(H2,34,35,36) |
| InChIKey | BFSXOUOYAACBTH-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|