C20H36N2O — CID 143586095
ethane;1-ethyl-N-[2-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]oxyprop-2-enyl]piperidin-4-amine (PubChem CID 143586095) has the molecular formula C20H36N2O and a molecular weight of 320.52 g/mol. Its IUPAC name is ethane;1-ethyl-N-[2-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]oxyprop-2-enyl]piperidin-4-amine.
| Compound Name | ethane;1-ethyl-N-[2-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]oxyprop-2-enyl]piperidin-4-amine |
|---|---|
| PubChem CID | 143586095 |
| Molecular Formula | C20H36N2O |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.28 |
| IUPAC Name | ethane;1-ethyl-N-[2-[(3E,5Z)-3-methylhepta-1,3,5-trien-2-yl]oxyprop-2-enyl]piperidin-4-amine |
| SMILES | C=C(CNC1CCN(CC)CC1)OC(=C)/C(C)=C/C=C\C.CC |
| InChI | InChI=1S/C18H30N2O.C2H6/c1-6-8-9-15(3)17(5)21-16(4)14-19-18-10-12-20(7-2)13-11-18;1-2/h6,8-9,18-19H,4-5,7,10-14H2,1-3H3;1-2H3/b8-6-,15-9+; |
| InChIKey | DDUKJSXRVDMZGA-JBRUHATBSA-N |
| XLogP | 4.65 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|