About (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane
(4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane (PubChem CID 143586114) has the molecular formula C17H33N
and a molecular weight of 251.46 g/mol. Its IUPAC name is (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane.
Molecular Properties
| Compound Name | (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane |
| PubChem CID | 143586114 |
| Molecular Formula | C17H33N |
| Molecular Weight | 251.46 g/mol |
| Exact Mass | 251.26 |
| IUPAC Name | (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane |
| SMILES | C=C(C)/C=C\C(=N\C=C(C)C)C(C)C.CC.CC |
| InChI | InChI=1S/C13H21N.2C2H6/c1-10(2)7-8-13(12(5)6)14-9-11(3)4;2*1-2/h7-9,12H,1H2,2-6H3;2*1-2H3/b8-7-,14-13-;; |
| InChIKey | XZQZKOVLUGLMQO-DWVLHCSLSA-N |
| XLogP | 6.19 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.46 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane?
The IUPAC name of (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane (CID 143586114) is (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane.
What is the SMILES notation for (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane?
The canonical SMILES for (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane is C=C(C)/C=C\C(=N\C=C(C)C)C(C)C.CC.CC.
What is the InChIKey of (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane?
The InChIKey is XZQZKOVLUGLMQO-DWVLHCSLSA-N. The full InChI is InChI=1S/C13H21N.2C2H6/c1-10(2)7-8-13(12(5)6)14-9-11(3)4;2*1-2/h7-9,12H,1H2,2-6H3;2*1-2H3/b8-7-,14-13-;;.
What are the key properties of (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane?
(4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane has a molecular weight of 251.46 g/mol, XLogP of 6.19, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2,6-dimethyl-N-(2-methylprop-1-enyl)hepta-4,6-dien-3-imine;ethane is sourced from PubChem (CID 143586114), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).